ChemNet > CAS > 175201-70-4 4-(methylthio)-2-({[2-(methylthio)-3-pyridyl]carbonyl}amino)butanoic acid
175201-70-4 4-(methylthio)-2-({[2-(methylthio)-3-pyridyl]carbonyl}amino)butanoic acid
| product Name |
4-(methylthio)-2-({[2-(methylthio)-3-pyridyl]carbonyl}amino)butanoic acid |
| CAS No |
175201-70-4 |
| Synonyms |
N-{[2-(methylsulfanyl)pyridin-3-yl]carbonyl}methionine |
| Molecular Formula |
C12H16N2O3S2 |
| Molecular Weight |
300.397 |
| InChI |
InChI=1/C12H16N2O3S2/c1-18-7-5-9(12(16)17)14-10(15)8-4-3-6-13-11(8)19-2/h3-4,6,9H,5,7H2,1-2H3,(H,14,15)(H,16,17) |
| Molecular Structure |
![175201-70-4 4-(methylthio)-2-({[2-(methylthio)-3-pyridyl]carbonyl}amino)butanoic acid](https://images-a.chemnet.com/suppliers/chembase/cas11/cas175201-70-4.gif)
|
| Density |
1.33g/cm3 |
| Melting point |
157℃ |
| Boiling point |
572.1°C at 760 mmHg |
| Refractive index |
1.612 |
| Flash point |
299.8°C |
| Vapour Pressur |
6.31E-14mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
